3-Chloro-2-fluorobenzonitrile
Catalog No: FT-0642258
CAS No: 94087-40-8
- Chemical Name: 3-Chloro-2-fluorobenzonitrile
- Molecular Formula: C7H3ClFN
- Molecular Weight: 155.55
- InChI Key: CHKLNKWJIDQKFV-UHFFFAOYSA-N
- InChI: InChI=1S/C7H3ClFN/c8-6-3-1-2-5(4-10)7(6)9/h1-3H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 94087-40-8 |
| Flash_Point: | 78.6±21.8 °C |
| Product_Name: | 3-Chloro-2-fluorobenzonitrile |
| Bolling_Point: | 206.3±20.0 °C at 760 mmHg |
| FW: | 155.557 |
| Melting_Point: | 40-44ºC |
| MF: | C7H3ClFN |
| Density: | 1.3±0.1 g/cm3 |
| Refractive_Index: | 1.537 |
|---|---|
| Vapor_Pressure: | 0.2±0.4 mmHg at 25°C |
| Flash_Point: | 78.6±21.8 °C |
| LogP: | 2.31 |
| Bolling_Point: | 206.3±20.0 °C at 760 mmHg |
| FW: | 155.557 |
| PSA: | 23.79000 |
| Melting_Point: | 40-44ºC |
| MF: | C7H3ClFN |
| Exact_Mass: | 154.993805 |
| Density: | 1.3±0.1 g/cm3 |
| Symbol: | GHS07 |
|---|---|
| Risk_Statements(EU): | R20/21/22 |
| HS_Code: | 2926909090 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xn:Harmful; |
| Warning_Statement: | P280 |
| Safety_Statements: | H312-H332 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)